C9H20N6O3 — CID 154154263
1,6-bis(carbamoylamino)hexan-3-ylurea (PubChem CID 154154263) has the molecular formula C9H20N6O3 and a molecular weight of 260.30 g/mol. Its IUPAC name is 1,6-bis(carbamoylamino)hexan-3-ylurea.
| Compound Name | 1,6-bis(carbamoylamino)hexan-3-ylurea |
|---|---|
| PubChem CID | 154154263 |
| Molecular Formula | C9H20N6O3 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1,6-bis(carbamoylamino)hexan-3-ylurea |
| SMILES | NC(=O)NCCCC(CCNC(N)=O)NC(N)=O |
| InChI | InChI=1S/C9H20N6O3/c10-7(16)13-4-1-2-6(15-9(12)18)3-5-14-8(11)17/h6H,1-5H2,(H3,10,13,16)(H3,11,14,17)(H3,12,15,18) |
| InChIKey | CNYTWDAEHAFNTJ-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|