C12H26N2O4 — CID 150562365
(4,4,4-triethoxy-3-methylbutyl)urea (PubChem CID 150562365) has the molecular formula C12H26N2O4 and a molecular weight of 262.35 g/mol. Its IUPAC name is (4,4,4-triethoxy-3-methylbutyl)urea.
| Compound Name | (4,4,4-triethoxy-3-methylbutyl)urea |
|---|---|
| PubChem CID | 150562365 |
| Molecular Formula | C12H26N2O4 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (4,4,4-triethoxy-3-methylbutyl)urea |
| SMILES | CCOC(OCC)(OCC)C(C)CCNC(N)=O |
| InChI | InChI=1S/C12H26N2O4/c1-5-16-12(17-6-2,18-7-3)10(4)8-9-14-11(13)15/h10H,5-9H2,1-4H3,(H3,13,14,15) |
| InChIKey | IKCNJAYQCFBRDJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|