C11H24N2O3 — CID 150757401
(4,4-diethoxy-3-methylpentyl)urea (PubChem CID 150757401) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is (4,4-diethoxy-3-methylpentyl)urea.
| Compound Name | (4,4-diethoxy-3-methylpentyl)urea |
|---|---|
| PubChem CID | 150757401 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (4,4-diethoxy-3-methylpentyl)urea |
| SMILES | CCOC(C)(OCC)C(C)CCNC(N)=O |
| InChI | InChI=1S/C11H24N2O3/c1-5-15-11(4,16-6-2)9(3)7-8-13-10(12)14/h9H,5-8H2,1-4H3,(H3,12,13,14) |
| InChIKey | JXDDEMHVWLFCFD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|