C17H34N2O4 — CID 138542776
(3-methyl-4,4,5-tripropoxyhex-5-enyl)urea (PubChem CID 138542776) has the molecular formula C17H34N2O4 and a molecular weight of 330.47 g/mol. Its IUPAC name is (3-methyl-4,4,5-tripropoxyhex-5-enyl)urea.
| Compound Name | (3-methyl-4,4,5-tripropoxyhex-5-enyl)urea |
|---|---|
| PubChem CID | 138542776 |
| Molecular Formula | C17H34N2O4 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | (3-methyl-4,4,5-tripropoxyhex-5-enyl)urea |
| SMILES | C=C(OCCC)C(OCCC)(OCCC)C(C)CCNC(N)=O |
| InChI | InChI=1S/C17H34N2O4/c1-6-11-21-15(5)17(22-12-7-2,23-13-8-3)14(4)9-10-19-16(18)20/h14H,5-13H2,1-4H3,(H3,18,19,20) |
| InChIKey | IRLZYIXAFMNLTI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|