C11H26N2O3Si — CID 175352143
3-(1,1-diethoxypropylsilyl)propylurea (PubChem CID 175352143) has the molecular formula C11H26N2O3Si and a molecular weight of 262.43 g/mol. Its IUPAC name is 3-(1,1-diethoxypropylsilyl)propylurea.
| Compound Name | 3-(1,1-diethoxypropylsilyl)propylurea |
|---|---|
| PubChem CID | 175352143 |
| Molecular Formula | C11H26N2O3Si |
| Molecular Weight | 262.43 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-(1,1-diethoxypropylsilyl)propylurea |
| SMILES | CCOC(CC)(OCC)[SiH2]CCCNC(N)=O |
| InChI | InChI=1S/C11H26N2O3Si/c1-4-11(15-5-2,16-6-3)17-9-7-8-13-10(12)14/h4-9,17H2,1-3H3,(H3,12,13,14) |
| InChIKey | PDKKBZVOAVUNCN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.43 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|