C11H26N2O4Si — CID 154499859
3-(3,3-diethoxypropoxysilyl)propylurea (PubChem CID 154499859) has the molecular formula C11H26N2O4Si and a molecular weight of 278.42 g/mol. Its IUPAC name is 3-(3,3-diethoxypropoxysilyl)propylurea.
| Compound Name | 3-(3,3-diethoxypropoxysilyl)propylurea |
|---|---|
| PubChem CID | 154499859 |
| Molecular Formula | C11H26N2O4Si |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 3-(3,3-diethoxypropoxysilyl)propylurea |
| SMILES | CCOC(CCO[SiH2]CCCNC(N)=O)OCC |
| InChI | InChI=1S/C11H26N2O4Si/c1-3-15-10(16-4-2)6-8-17-18-9-5-7-13-11(12)14/h10H,3-9,18H2,1-2H3,(H3,12,13,14) |
| InChIKey | XERAKFCBBRZPAA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|