C11H25NO7Si — CID 123937255
(3S,4R,5R)-N-(3-ethoxysilylpropyl)-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 123937255) has the molecular formula C11H25NO7Si and a molecular weight of 311.41 g/mol. Its IUPAC name is (3S,4R,5R)-N-(3-ethoxysilylpropyl)-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | (3S,4R,5R)-N-(3-ethoxysilylpropyl)-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 123937255 |
| Molecular Formula | C11H25NO7Si |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (3S,4R,5R)-N-(3-ethoxysilylpropyl)-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | CCO[SiH2]CCCNC(=O)C(O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H25NO7Si/c1-2-19-20-5-3-4-12-11(18)10(17)9(16)8(15)7(14)6-13/h7-10,13-17H,2-6,20H2,1H3,(H,12,18)/t7-,8-,9+,10?/m1/s1 |
| InChIKey | DTTJQMUDRVFQDZ-HNJRMYHASA-N |
| XLogP | -3.53 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|