C9H23NO7Si2 — CID 123787927
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-(3-silyloxysilylpropyl)hexanamide (PubChem CID 123787927) has the molecular formula C9H23NO7Si2 and a molecular weight of 313.46 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-(3-silyloxysilylpropyl)hexanamide.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-(3-silyloxysilylpropyl)hexanamide |
|---|---|
| PubChem CID | 123787927 |
| Molecular Formula | C9H23NO7Si2 |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-(3-silyloxysilylpropyl)hexanamide |
| SMILES | O=C(NCCC[SiH2]O[SiH3])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H23NO7Si2/c11-4-5(12)6(13)7(14)8(15)9(16)10-2-1-3-19-17-18/h5-8,11-15H,1-4,19H2,18H3,(H,10,16)/t5-,6-,7+,8-/m1/s1 |
| InChIKey | UHIPVLITKVEMLL-OOJXKGFFSA-N |
| XLogP | -5.27 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | -5.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|