C15H33NO9Si — CID 60622991
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-(3-triethoxysilylpropyl)hexanamide (PubChem CID 60622991) has the molecular formula C15H33NO9Si and a molecular weight of 399.51 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-(3-triethoxysilylpropyl)hexanamide.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-(3-triethoxysilylpropyl)hexanamide |
|---|---|
| PubChem CID | 60622991 |
| Molecular Formula | C15H33NO9Si |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-N-(3-triethoxysilylpropyl)hexanamide |
| SMILES | CCO[Si](CCCNC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)(OCC)OCC |
| InChI | InChI=1S/C15H33NO9Si/c1-4-23-26(24-5-2,25-6-3)9-7-8-16-15(22)14(21)13(20)12(19)11(18)10-17/h11-14,17-21H,4-10H2,1-3H3,(H,16,22)/t11-,12-,13+,14-/m1/s1 |
| InChIKey | RGFDUEXNZLUZGH-YIYPIFLZSA-N |
| XLogP | -2.02 |
| TPSA | 157.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|