C19H47N3O7Si2 — CID 88634615
3-triethoxysilylpropan-1-amine;3-triethoxysilylpropylurea (PubChem CID 88634615) has the molecular formula C19H47N3O7Si2 and a molecular weight of 485.77 g/mol. Its IUPAC name is 3-triethoxysilylpropan-1-amine;3-triethoxysilylpropylurea.
| Compound Name | 3-triethoxysilylpropan-1-amine;3-triethoxysilylpropylurea |
|---|---|
| PubChem CID | 88634615 |
| Molecular Formula | C19H47N3O7Si2 |
| Molecular Weight | 485.77 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 3-triethoxysilylpropan-1-amine;3-triethoxysilylpropylurea |
| SMILES | CCO[Si](CCCN)(OCC)OCC.CCO[Si](CCCNC(N)=O)(OCC)OCC |
| InChI | InChI=1S/C10H24N2O4Si.C9H23NO3Si/c1-4-14-17(15-5-2,16-6-3)9-7-8-12-10(11)13;1-4-11-14(12-5-2,13-6-3)9-7-8-10/h4-9H2,1-3H3,(H3,11,12,13);4-10H2,1-3H3 |
| InChIKey | MIKANCXDDSSEKF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 136.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.77 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|