C20H50N2O6Si2 — CID 88688172
N-ethyl-3-triethoxysilylpropan-1-amine;3-triethoxysilylpropan-1-amine (PubChem CID 88688172) has the molecular formula C20H50N2O6Si2 and a molecular weight of 470.80 g/mol. Its IUPAC name is N-ethyl-3-triethoxysilylpropan-1-amine;3-triethoxysilylpropan-1-amine.
| Compound Name | N-ethyl-3-triethoxysilylpropan-1-amine;3-triethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 88688172 |
| Molecular Formula | C20H50N2O6Si2 |
| Molecular Weight | 470.80 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | N-ethyl-3-triethoxysilylpropan-1-amine;3-triethoxysilylpropan-1-amine |
| SMILES | CCNCCC[Si](OCC)(OCC)OCC.CCO[Si](CCCN)(OCC)OCC |
| InChI | InChI=1S/C11H27NO3Si.C9H23NO3Si/c1-5-12-10-9-11-16(13-6-2,14-7-3)15-8-4;1-4-11-14(12-5-2,13-6-3)9-7-8-10/h12H,5-11H2,1-4H3;4-10H2,1-3H3 |
| InChIKey | PNHMKFCGLVNTJL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.80 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|