About N-ethyl-3-triethoxysilylpropan-1-amine;silane
N-ethyl-3-triethoxysilylpropan-1-amine;silane (PubChem CID 161213931) has the molecular formula C11H31NO3Si2
and a molecular weight of 281.54 g/mol. Its IUPAC name is N-ethyl-3-triethoxysilylpropan-1-amine;silane.
Molecular Properties
| Compound Name | N-ethyl-3-triethoxysilylpropan-1-amine;silane |
| PubChem CID | 161213931 |
| Molecular Formula | C11H31NO3Si2 |
| Molecular Weight | 281.54 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | N-ethyl-3-triethoxysilylpropan-1-amine;silane |
| SMILES | CCNCCC[Si](OCC)(OCC)OCC.[SiH4] |
| InChI | InChI=1S/C11H27NO3Si.H4Si/c1-5-12-10-9-11-16(13-6-2,14-7-3)15-8-4;/h12H,5-11H2,1-4H3;1H4 |
| InChIKey | UWPJGILBQRHAAQ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.54 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3-triethoxysilylpropan-1-amine;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-triethoxysilylpropan-1-amine;silane?
The IUPAC name of N-ethyl-3-triethoxysilylpropan-1-amine;silane (CID 161213931) is N-ethyl-3-triethoxysilylpropan-1-amine;silane.
What is the SMILES notation for N-ethyl-3-triethoxysilylpropan-1-amine;silane?
The canonical SMILES for N-ethyl-3-triethoxysilylpropan-1-amine;silane is CCNCCC[Si](OCC)(OCC)OCC.[SiH4].
What is the InChIKey of N-ethyl-3-triethoxysilylpropan-1-amine;silane?
The InChIKey is UWPJGILBQRHAAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H27NO3Si.H4Si/c1-5-12-10-9-11-16(13-6-2,14-7-3)15-8-4;/h12H,5-11H2,1-4H3;1H4.
What are the key properties of N-ethyl-3-triethoxysilylpropan-1-amine;silane?
N-ethyl-3-triethoxysilylpropan-1-amine;silane has a molecular weight of 281.54 g/mol, XLogP of 0.58, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-triethoxysilylpropan-1-amine;silane is sourced from PubChem (CID 161213931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).