C14H34N2O5Si — CID 59782810
2-[2-hydroxyethyl-[(3-triethoxysilylpropylamino)methyl]amino]ethanol (PubChem CID 59782810) has the molecular formula C14H34N2O5Si and a molecular weight of 338.52 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-[(3-triethoxysilylpropylamino)methyl]amino]ethanol.
| Compound Name | 2-[2-hydroxyethyl-[(3-triethoxysilylpropylamino)methyl]amino]ethanol |
|---|---|
| PubChem CID | 59782810 |
| Molecular Formula | C14H34N2O5Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 2-[2-hydroxyethyl-[(3-triethoxysilylpropylamino)methyl]amino]ethanol |
| SMILES | CCO[Si](CCCNCN(CCO)CCO)(OCC)OCC |
| InChI | InChI=1S/C14H34N2O5Si/c1-4-19-22(20-5-2,21-6-3)13-7-8-15-14-16(9-11-17)10-12-18/h15,17-18H,4-14H2,1-3H3 |
| InChIKey | LIOMZGAFYWBUIG-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|