C19H45NO7Si2 — CID 159716952
2-[3-[diethoxy(methoxy)silyl]propyl-(3-triethoxysilylpropyl)amino]ethanol (PubChem CID 159716952) has the molecular formula C19H45NO7Si2 and a molecular weight of 455.74 g/mol. Its IUPAC name is 2-[3-[diethoxy(methoxy)silyl]propyl-(3-triethoxysilylpropyl)amino]ethanol.
| Compound Name | 2-[3-[diethoxy(methoxy)silyl]propyl-(3-triethoxysilylpropyl)amino]ethanol |
|---|---|
| PubChem CID | 159716952 |
| Molecular Formula | C19H45NO7Si2 |
| Molecular Weight | 455.74 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 2-[3-[diethoxy(methoxy)silyl]propyl-(3-triethoxysilylpropyl)amino]ethanol |
| SMILES | CCO[Si](CCCN(CCO)CCC[Si](OCC)(OCC)OCC)(OC)OCC |
| InChI | InChI=1S/C19H45NO7Si2/c1-7-23-28(22-6,24-8-2)18-12-14-20(16-17-21)15-13-19-29(25-9-3,26-10-4)27-11-5/h21H,7-19H2,1-6H3 |
| InChIKey | CWDOXMQQHPRZQL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.74 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|