C20H47N3O3Si — CID 140647739
N'-[3-(diethylamino)propyl]-N,N-diethyl-N'-(3-trimethoxysilylpropyl)propane-1,3-diamine (PubChem CID 140647739) has the molecular formula C20H47N3O3Si and a molecular weight of 405.70 g/mol. Its IUPAC name is N'-[3-(diethylamino)propyl]-N,N-diethyl-N'-(3-trimethoxysilylpropyl)propane-1,3-diamine.
| Compound Name | N'-[3-(diethylamino)propyl]-N,N-diethyl-N'-(3-trimethoxysilylpropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 140647739 |
| Molecular Formula | C20H47N3O3Si |
| Molecular Weight | 405.70 g/mol |
| Exact Mass | 405.34 |
| IUPAC Name | N'-[3-(diethylamino)propyl]-N,N-diethyl-N'-(3-trimethoxysilylpropyl)propane-1,3-diamine |
| SMILES | CCN(CC)CCCN(CCCN(CC)CC)CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C20H47N3O3Si/c1-8-21(9-2)15-12-17-23(18-13-16-22(10-3)11-4)19-14-20-27(24-5,25-6)26-7/h8-20H2,1-7H3 |
| InChIKey | GTFPVXWGHCKTKK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.70 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|