C22H51N3O2Si — CID 140647314
N'-[3-[diethoxy(methyl)silyl]propyl]-N'-[3-(diethylamino)propyl]-N,N-diethylpropane-1,3-diamine (PubChem CID 140647314) has the molecular formula C22H51N3O2Si and a molecular weight of 417.76 g/mol. Its IUPAC name is N'-[3-[diethoxy(methyl)silyl]propyl]-N'-[3-(diethylamino)propyl]-N,N-diethylpropane-1,3-diamine.
| Compound Name | N'-[3-[diethoxy(methyl)silyl]propyl]-N'-[3-(diethylamino)propyl]-N,N-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 140647314 |
| Molecular Formula | C22H51N3O2Si |
| Molecular Weight | 417.76 g/mol |
| Exact Mass | 417.38 |
| IUPAC Name | N'-[3-[diethoxy(methyl)silyl]propyl]-N'-[3-(diethylamino)propyl]-N,N-diethylpropane-1,3-diamine |
| SMILES | CCO[Si](C)(CCCN(CCCN(CC)CC)CCCN(CC)CC)OCC |
| InChI | InChI=1S/C22H51N3O2Si/c1-8-23(9-2)17-14-19-25(20-15-18-24(10-3)11-4)21-16-22-28(7,26-12-5)27-13-6/h8-22H2,1-7H3 |
| InChIKey | DGRKKGQAXHBFCA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.76 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|