C19H43NO4Si2 — CID 88852037
triethylsilyl 3-[3-[diethoxy(methyl)silyl]propyl-ethylamino]propanoate (PubChem CID 88852037) has the molecular formula C19H43NO4Si2 and a molecular weight of 405.73 g/mol. Its IUPAC name is triethylsilyl 3-[3-[diethoxy(methyl)silyl]propyl-ethylamino]propanoate.
| Compound Name | triethylsilyl 3-[3-[diethoxy(methyl)silyl]propyl-ethylamino]propanoate |
|---|---|
| PubChem CID | 88852037 |
| Molecular Formula | C19H43NO4Si2 |
| Molecular Weight | 405.73 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | triethylsilyl 3-[3-[diethoxy(methyl)silyl]propyl-ethylamino]propanoate |
| SMILES | CCO[Si](C)(CCCN(CC)CCC(=O)O[Si](CC)(CC)CC)OCC |
| InChI | InChI=1S/C19H43NO4Si2/c1-8-20(16-14-18-25(7,22-9-2)23-10-3)17-15-19(21)24-26(11-4,12-5)13-6/h8-18H2,1-7H3 |
| InChIKey | OYAYWICEMPXFCO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.73 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|