C23H51NO4Si2 — CID 140591252
tri(propan-2-yl)silyl 2-[3-(butan-2-yloxy-ethoxy-methylsilyl)propyl-ethylamino]acetate (PubChem CID 140591252) has the molecular formula C23H51NO4Si2 and a molecular weight of 461.84 g/mol. Its IUPAC name is tri(propan-2-yl)silyl 2-[3-(butan-2-yloxy-ethoxy-methylsilyl)propyl-ethylamino]acetate.
| Compound Name | tri(propan-2-yl)silyl 2-[3-(butan-2-yloxy-ethoxy-methylsilyl)propyl-ethylamino]acetate |
|---|---|
| PubChem CID | 140591252 |
| Molecular Formula | C23H51NO4Si2 |
| Molecular Weight | 461.84 g/mol |
| Exact Mass | 461.34 |
| IUPAC Name | tri(propan-2-yl)silyl 2-[3-(butan-2-yloxy-ethoxy-methylsilyl)propyl-ethylamino]acetate |
| SMILES | CCO[Si](C)(CCCN(CC)CC(=O)O[Si](C(C)C)(C(C)C)C(C)C)OC(C)CC |
| InChI | InChI=1S/C23H51NO4Si2/c1-12-22(10)27-29(11,26-14-3)17-15-16-24(13-2)18-23(25)28-30(19(4)5,20(6)7)21(8)9/h19-22H,12-18H2,1-11H3 |
| InChIKey | UOXRPSMNTITJFY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.84 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|