C18H41NO5Si2 — CID 140591259
trimethylsilyl 2-[3-[butan-2-yloxy(diethoxy)silyl]propyl-ethylamino]acetate (PubChem CID 140591259) has the molecular formula C18H41NO5Si2 and a molecular weight of 407.70 g/mol. Its IUPAC name is trimethylsilyl 2-[3-[butan-2-yloxy(diethoxy)silyl]propyl-ethylamino]acetate.
| Compound Name | trimethylsilyl 2-[3-[butan-2-yloxy(diethoxy)silyl]propyl-ethylamino]acetate |
|---|---|
| PubChem CID | 140591259 |
| Molecular Formula | C18H41NO5Si2 |
| Molecular Weight | 407.70 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | trimethylsilyl 2-[3-[butan-2-yloxy(diethoxy)silyl]propyl-ethylamino]acetate |
| SMILES | CCO[Si](CCCN(CC)CC(=O)O[Si](C)(C)C)(OCC)OC(C)CC |
| InChI | InChI=1S/C18H41NO5Si2/c1-9-17(5)23-26(21-11-3,22-12-4)15-13-14-19(10-2)16-18(20)24-25(6,7)8/h17H,9-16H2,1-8H3 |
| InChIKey | LLQUDJKTZBPYJQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.70 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|