C19H35NO3Si2 — CID 140591241
trimethylsilyl N-[3-[butan-2-yloxy(dimethyl)silyl]propyl]-N-phenylcarbamate (PubChem CID 140591241) has the molecular formula C19H35NO3Si2 and a molecular weight of 381.67 g/mol. Its IUPAC name is trimethylsilyl N-[3-[butan-2-yloxy(dimethyl)silyl]propyl]-N-phenylcarbamate.
| Compound Name | trimethylsilyl N-[3-[butan-2-yloxy(dimethyl)silyl]propyl]-N-phenylcarbamate |
|---|---|
| PubChem CID | 140591241 |
| Molecular Formula | C19H35NO3Si2 |
| Molecular Weight | 381.67 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | trimethylsilyl N-[3-[butan-2-yloxy(dimethyl)silyl]propyl]-N-phenylcarbamate |
| SMILES | CCC(C)O[Si](C)(C)CCCN(C(=O)O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H35NO3Si2/c1-8-17(2)22-25(6,7)16-12-15-20(18-13-10-9-11-14-18)19(21)23-24(3,4)5/h9-11,13-14,17H,8,12,15-16H2,1-7H3 |
| InChIKey | XGLWPQVIFAOFAY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|