C18H41NO4Si2 — CID 140591113
triethylsilyl N-[3-(butan-2-yloxy-ethoxy-methylsilyl)propyl]-N-methylcarbamate (PubChem CID 140591113) has the molecular formula C18H41NO4Si2 and a molecular weight of 391.70 g/mol. Its IUPAC name is triethylsilyl N-[3-(butan-2-yloxy-ethoxy-methylsilyl)propyl]-N-methylcarbamate.
| Compound Name | triethylsilyl N-[3-(butan-2-yloxy-ethoxy-methylsilyl)propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 140591113 |
| Molecular Formula | C18H41NO4Si2 |
| Molecular Weight | 391.70 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | triethylsilyl N-[3-(butan-2-yloxy-ethoxy-methylsilyl)propyl]-N-methylcarbamate |
| SMILES | CCO[Si](C)(CCCN(C)C(=O)O[Si](CC)(CC)CC)OC(C)CC |
| InChI | InChI=1S/C18H41NO4Si2/c1-9-17(6)22-24(8,21-10-2)16-14-15-19(7)18(20)23-25(11-3,12-4)13-5/h17H,9-16H2,1-8H3 |
| InChIKey | KHOSRVUCQCMGKN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.70 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|