C13H27NO3Si — CID 139724660
N-[3-[diethoxy(methyl)silyl]propyl]-N,2-dimethylprop-2-enamide (PubChem CID 139724660) has the molecular formula C13H27NO3Si and a molecular weight of 273.45 g/mol. Its IUPAC name is N-[3-[diethoxy(methyl)silyl]propyl]-N,2-dimethylprop-2-enamide.
| Compound Name | N-[3-[diethoxy(methyl)silyl]propyl]-N,2-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 139724660 |
| Molecular Formula | C13H27NO3Si |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-[3-[diethoxy(methyl)silyl]propyl]-N,2-dimethylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)CCC[Si](C)(OCC)OCC |
| InChI | InChI=1S/C13H27NO3Si/c1-7-16-18(6,17-8-2)11-9-10-14(5)13(15)12(3)4/h3,7-11H2,1-2,4-6H3 |
| InChIKey | FVQIQOJDRMWBRB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|