C18H32N2O4 — CID 21285723
N,2-dimethyl-N-[3-[1-[3-[methyl(2-methylprop-2-enoyl)amino]propoxy]ethoxy]propyl]prop-2-enamide (PubChem CID 21285723) has the molecular formula C18H32N2O4 and a molecular weight of 340.46 g/mol. Its IUPAC name is N,2-dimethyl-N-[3-[1-[3-[methyl(2-methylprop-2-enoyl)amino]propoxy]ethoxy]propyl]prop-2-enamide.
| Compound Name | N,2-dimethyl-N-[3-[1-[3-[methyl(2-methylprop-2-enoyl)amino]propoxy]ethoxy]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 21285723 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | N,2-dimethyl-N-[3-[1-[3-[methyl(2-methylprop-2-enoyl)amino]propoxy]ethoxy]propyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)CCCOC(C)OCCCN(C)C(=O)C(=C)C |
| InChI | InChI=1S/C18H32N2O4/c1-14(2)17(21)19(6)10-8-12-23-16(5)24-13-9-11-20(7)18(22)15(3)4/h16H,1,3,8-13H2,2,4-7H3 |
| InChIKey | WAGLNVZPZCSSSZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|