C11H21NO2 — CID 174975704
N-butyl-N-(2-hydroxypropyl)-2-methylprop-2-enamide (PubChem CID 174975704) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is N-butyl-N-(2-hydroxypropyl)-2-methylprop-2-enamide.
| Compound Name | N-butyl-N-(2-hydroxypropyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 174975704 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | N-butyl-N-(2-hydroxypropyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(CCCC)CC(C)O |
| InChI | InChI=1S/C11H21NO2/c1-5-6-7-12(8-10(4)13)11(14)9(2)3/h10,13H,2,5-8H2,1,3-4H3 |
| InChIKey | BVPKAJAKSXKDHN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|