C19H20F17NO — CID 21020754
N-butyl-N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-2-methylprop-2-enamide (PubChem CID 21020754) has the molecular formula C19H20F17NO and a molecular weight of 601.34 g/mol. Its IUPAC name is N-butyl-N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-2-methylprop-2-enamide.
| Compound Name | N-butyl-N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 21020754 |
| Molecular Formula | C19H20F17NO |
| Molecular Weight | 601.34 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | N-butyl-N-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(CCCC)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H20F17NO/c1-4-5-8-37(11(38)10(2)3)9-6-7-12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)18(32,33)19(34,35)36/h2,4-9H2,1,3H3 |
| InChIKey | UODDKRXDWAHQFI-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.34 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|