C19H39NOSi — CID 59819360
N-(3-butyl-3-trimethylsilylheptyl)-N,2-dimethylprop-2-enamide (PubChem CID 59819360) has the molecular formula C19H39NOSi and a molecular weight of 325.61 g/mol. Its IUPAC name is N-(3-butyl-3-trimethylsilylheptyl)-N,2-dimethylprop-2-enamide.
| Compound Name | N-(3-butyl-3-trimethylsilylheptyl)-N,2-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 59819360 |
| Molecular Formula | C19H39NOSi |
| Molecular Weight | 325.61 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | N-(3-butyl-3-trimethylsilylheptyl)-N,2-dimethylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)CCC(CCCC)(CCCC)[Si](C)(C)C |
| InChI | InChI=1S/C19H39NOSi/c1-9-11-13-19(14-12-10-2,22(6,7)8)15-16-20(5)18(21)17(3)4/h3,9-16H2,1-2,4-8H3 |
| InChIKey | WSOUMYTYFOHCCK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|