C21H47NO4Si2 — CID 140591101
tri(propan-2-yl)silyl 2-[3-(butan-2-yloxy-ethoxy-methylsilyl)propylamino]acetate (PubChem CID 140591101) has the molecular formula C21H47NO4Si2 and a molecular weight of 433.78 g/mol. Its IUPAC name is tri(propan-2-yl)silyl 2-[3-(butan-2-yloxy-ethoxy-methylsilyl)propylamino]acetate.
| Compound Name | tri(propan-2-yl)silyl 2-[3-(butan-2-yloxy-ethoxy-methylsilyl)propylamino]acetate |
|---|---|
| PubChem CID | 140591101 |
| Molecular Formula | C21H47NO4Si2 |
| Molecular Weight | 433.78 g/mol |
| Exact Mass | 433.30 |
| IUPAC Name | tri(propan-2-yl)silyl 2-[3-(butan-2-yloxy-ethoxy-methylsilyl)propylamino]acetate |
| SMILES | CCO[Si](C)(CCCNCC(=O)O[Si](C(C)C)(C(C)C)C(C)C)OC(C)CC |
| InChI | InChI=1S/C21H47NO4Si2/c1-11-20(9)25-27(10,24-12-2)15-13-14-22-16-21(23)26-28(17(3)4,18(5)6)19(7)8/h17-20,22H,11-16H2,1-10H3 |
| InChIKey | IUKWCZZAHUYNNN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.78 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|