C20H45NO4Si2 — CID 174659298
tri(propan-2-yl)silyl N-[3-[diethoxy(methyl)silyl]pentyl]carbamate (PubChem CID 174659298) has the molecular formula C20H45NO4Si2 and a molecular weight of 419.76 g/mol. Its IUPAC name is tri(propan-2-yl)silyl N-[3-[diethoxy(methyl)silyl]pentyl]carbamate.
| Compound Name | tri(propan-2-yl)silyl N-[3-[diethoxy(methyl)silyl]pentyl]carbamate |
|---|---|
| PubChem CID | 174659298 |
| Molecular Formula | C20H45NO4Si2 |
| Molecular Weight | 419.76 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | tri(propan-2-yl)silyl N-[3-[diethoxy(methyl)silyl]pentyl]carbamate |
| SMILES | CCO[Si](C)(OCC)C(CC)CCNC(=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H45NO4Si2/c1-11-19(26(10,23-12-2)24-13-3)14-15-21-20(22)25-27(16(4)5,17(6)7)18(8)9/h16-19H,11-15H2,1-10H3,(H,21,22) |
| InChIKey | GVHOGBUENQMVNB-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.76 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|