C18H31NO3Si — CID 10640703
tri(propan-2-yl)silyl N-[2-(3-hydroxyphenyl)ethyl]carbamate (PubChem CID 10640703) has the molecular formula C18H31NO3Si and a molecular weight of 337.54 g/mol. Its IUPAC name is tri(propan-2-yl)silyl N-[2-(3-hydroxyphenyl)ethyl]carbamate.
| Compound Name | tri(propan-2-yl)silyl N-[2-(3-hydroxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 10640703 |
| Molecular Formula | C18H31NO3Si |
| Molecular Weight | 337.54 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | tri(propan-2-yl)silyl N-[2-(3-hydroxyphenyl)ethyl]carbamate |
| SMILES | CC(C)[Si](OC(=O)NCCc1cccc(O)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H31NO3Si/c1-13(2)23(14(3)4,15(5)6)22-18(21)19-11-10-16-8-7-9-17(20)12-16/h7-9,12-15,20H,10-11H2,1-6H3,(H,19,21) |
| InChIKey | ZMZYSHPDAQEFLY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|