C13H30N2O4Si2 — CID 174061171
trimethylsilyl N-[5-(trimethylsilyloxycarbonylamino)pentyl]carbamate (PubChem CID 174061171) has the molecular formula C13H30N2O4Si2 and a molecular weight of 334.57 g/mol. Its IUPAC name is trimethylsilyl N-[5-(trimethylsilyloxycarbonylamino)pentyl]carbamate.
| Compound Name | trimethylsilyl N-[5-(trimethylsilyloxycarbonylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 174061171 |
| Molecular Formula | C13H30N2O4Si2 |
| Molecular Weight | 334.57 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | trimethylsilyl N-[5-(trimethylsilyloxycarbonylamino)pentyl]carbamate |
| SMILES | C[Si](C)(C)OC(=O)NCCCCCNC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C13H30N2O4Si2/c1-20(2,3)18-12(16)14-10-8-7-9-11-15-13(17)19-21(4,5)6/h7-11H2,1-6H3,(H,14,16)(H,15,17) |
| InChIKey | JSDVVXDLOLCXKJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|