C18H37NO5Si — CID 156663033
4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-tri(propan-2-yl)silyloxybutanoic acid (PubChem CID 156663033) has the molecular formula C18H37NO5Si and a molecular weight of 375.58 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-tri(propan-2-yl)silyloxybutanoic acid.
| Compound Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-tri(propan-2-yl)silyloxybutanoic acid |
|---|---|
| PubChem CID | 156663033 |
| Molecular Formula | C18H37NO5Si |
| Molecular Weight | 375.58 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-tri(propan-2-yl)silyloxybutanoic acid |
| SMILES | CC(C)[Si](OC(CCNC(=O)OC(C)(C)C)C(=O)O)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H37NO5Si/c1-12(2)25(13(3)4,14(5)6)24-15(16(20)21)10-11-19-17(22)23-18(7,8)9/h12-15H,10-11H2,1-9H3,(H,19,22)(H,20,21) |
| InChIKey | AOXHFGOFYCPSCU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|