C30H65NO6Si3 — CID 88852246
bis[tri(propan-2-yl)silyl] 2-[3-[diethoxy(methyl)silyl]propylamino]butanedioate (PubChem CID 88852246) has the molecular formula C30H65NO6Si3 and a molecular weight of 620.11 g/mol. Its IUPAC name is bis[tri(propan-2-yl)silyl] 2-[3-[diethoxy(methyl)silyl]propylamino]butanedioate.
| Compound Name | bis[tri(propan-2-yl)silyl] 2-[3-[diethoxy(methyl)silyl]propylamino]butanedioate |
|---|---|
| PubChem CID | 88852246 |
| Molecular Formula | C30H65NO6Si3 |
| Molecular Weight | 620.11 g/mol |
| Exact Mass | 619.41 |
| IUPAC Name | bis[tri(propan-2-yl)silyl] 2-[3-[diethoxy(methyl)silyl]propylamino]butanedioate |
| SMILES | CCO[Si](C)(CCCNC(CC(=O)O[Si](C(C)C)(C(C)C)C(C)C)C(=O)O[Si](C(C)C)(C(C)C)C(C)C)OCC |
| InChI | InChI=1S/C30H65NO6Si3/c1-16-34-38(15,35-17-2)20-18-19-31-28(30(33)37-40(25(9)10,26(11)12)27(13)14)21-29(32)36-39(22(3)4,23(5)6)24(7)8/h22-28,31H,16-21H2,1-15H3 |
| InChIKey | MAILCXDMQBNOOV-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.11 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|