C16H37NO6Si3 — CID 88852125
bis(trimethylsilyl) 2-[3-[dimethoxy(methyl)silyl]propylamino]butanedioate (PubChem CID 88852125) has the molecular formula C16H37NO6Si3 and a molecular weight of 423.73 g/mol. Its IUPAC name is bis(trimethylsilyl) 2-[3-[dimethoxy(methyl)silyl]propylamino]butanedioate.
| Compound Name | bis(trimethylsilyl) 2-[3-[dimethoxy(methyl)silyl]propylamino]butanedioate |
|---|---|
| PubChem CID | 88852125 |
| Molecular Formula | C16H37NO6Si3 |
| Molecular Weight | 423.73 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | bis(trimethylsilyl) 2-[3-[dimethoxy(methyl)silyl]propylamino]butanedioate |
| SMILES | CO[Si](C)(CCCNC(CC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C)OC |
| InChI | InChI=1S/C16H37NO6Si3/c1-20-26(9,21-2)12-10-11-17-14(16(19)23-25(6,7)8)13-15(18)22-24(3,4)5/h14,17H,10-13H2,1-9H3 |
| InChIKey | UBNDJRVEGZBDOY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.73 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|