C13H29NO5Si — CID 59782863
2-methoxyethyl 3-[3-[dimethoxy(methyl)silyl]propylamino]-2-methylpropanoate (PubChem CID 59782863) has the molecular formula C13H29NO5Si and a molecular weight of 307.46 g/mol. Its IUPAC name is 2-methoxyethyl 3-[3-[dimethoxy(methyl)silyl]propylamino]-2-methylpropanoate.
| Compound Name | 2-methoxyethyl 3-[3-[dimethoxy(methyl)silyl]propylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 59782863 |
| Molecular Formula | C13H29NO5Si |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 2-methoxyethyl 3-[3-[dimethoxy(methyl)silyl]propylamino]-2-methylpropanoate |
| SMILES | COCCOC(=O)C(C)CNCCC[Si](C)(OC)OC |
| InChI | InChI=1S/C13H29NO5Si/c1-12(13(15)19-9-8-16-2)11-14-7-6-10-20(5,17-3)18-4/h12,14H,6-11H2,1-5H3 |
| InChIKey | CCZYBYYDOMGIOO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|