C10H27N3O2Si — CID 141486440
1-N-[3-[dimethoxy(methyl)silyl]propyl]butane-1,2,4-triamine (PubChem CID 141486440) has the molecular formula C10H27N3O2Si and a molecular weight of 249.43 g/mol. Its IUPAC name is 1-N-[3-[dimethoxy(methyl)silyl]propyl]butane-1,2,4-triamine.
| Compound Name | 1-N-[3-[dimethoxy(methyl)silyl]propyl]butane-1,2,4-triamine |
|---|---|
| PubChem CID | 141486440 |
| Molecular Formula | C10H27N3O2Si |
| Molecular Weight | 249.43 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | 1-N-[3-[dimethoxy(methyl)silyl]propyl]butane-1,2,4-triamine |
| SMILES | CO[Si](C)(CCCNCC(N)CCN)OC |
| InChI | InChI=1S/C10H27N3O2Si/c1-14-16(3,15-2)8-4-7-13-9-10(12)5-6-11/h10,13H,4-9,11-12H2,1-3H3 |
| InChIKey | YNBIUGICGXOBEW-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.43 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|