C14H40N2O5Si4 — CID 156629335
N'-[3-[[methoxy(dimethyl)silyl]oxy-[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-methylsilyl]propyl]ethane-1,2-diamine (PubChem CID 156629335) has the molecular formula C14H40N2O5Si4 and a molecular weight of 428.83 g/mol. Its IUPAC name is N'-[3-[[methoxy(dimethyl)silyl]oxy-[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-methylsilyl]propyl]ethane-1,2-diamine.
| Compound Name | N'-[3-[[methoxy(dimethyl)silyl]oxy-[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-methylsilyl]propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 156629335 |
| Molecular Formula | C14H40N2O5Si4 |
| Molecular Weight | 428.83 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N'-[3-[[methoxy(dimethyl)silyl]oxy-[[methoxy(dimethyl)silyl]oxy-dimethylsilyl]oxy-methylsilyl]propyl]ethane-1,2-diamine |
| SMILES | CO[Si](C)(C)O[Si](C)(C)O[Si](C)(CCCNCCN)O[Si](C)(C)OC |
| InChI | InChI=1S/C14H40N2O5Si4/c1-17-22(3,4)19-24(7,8)21-25(9,20-23(5,6)18-2)14-10-12-16-13-11-15/h16H,10-15H2,1-9H3 |
| InChIKey | WSEJAYQOFGEKIA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.83 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|