C20H52N4O6Si3 — CID 169060435
N'-[3-[[[3-(2-aminoethylamino)propyl-diethoxysilyl]oxy-dimethylsilyl]oxy-diethoxysilyl]propyl]ethane-1,2-diamine (PubChem CID 169060435) has the molecular formula C20H52N4O6Si3 and a molecular weight of 528.92 g/mol. Its IUPAC name is N'-[3-[[[3-(2-aminoethylamino)propyl-diethoxysilyl]oxy-dimethylsilyl]oxy-diethoxysilyl]propyl]ethane-1,2-diamine.
| Compound Name | N'-[3-[[[3-(2-aminoethylamino)propyl-diethoxysilyl]oxy-dimethylsilyl]oxy-diethoxysilyl]propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 169060435 |
| Molecular Formula | C20H52N4O6Si3 |
| Molecular Weight | 528.92 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | N'-[3-[[[3-(2-aminoethylamino)propyl-diethoxysilyl]oxy-dimethylsilyl]oxy-diethoxysilyl]propyl]ethane-1,2-diamine |
| SMILES | CCO[Si](CCCNCCN)(OCC)O[Si](C)(C)O[Si](CCCNCCN)(OCC)OCC |
| InChI | InChI=1S/C20H52N4O6Si3/c1-7-25-32(26-8-2,19-11-15-23-17-13-21)29-31(5,6)30-33(27-9-3,28-10-4)20-12-16-24-18-14-22/h23-24H,7-22H2,1-6H3 |
| InChIKey | SHPABVJEWZHQCM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 131.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.92 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|