C32H76N2O11Si4 — CID 171623585
N-[3-[[diethoxy-[3-(3-triethoxysilylpropylamino)propyl]silyl]oxy-diethoxysilyl]propyl]-3-triethoxysilylpropan-1-amine (PubChem CID 171623585) has the molecular formula C32H76N2O11Si4 and a molecular weight of 777.31 g/mol. Its IUPAC name is N-[3-[[diethoxy-[3-(3-triethoxysilylpropylamino)propyl]silyl]oxy-diethoxysilyl]propyl]-3-triethoxysilylpropan-1-amine.
| Compound Name | N-[3-[[diethoxy-[3-(3-triethoxysilylpropylamino)propyl]silyl]oxy-diethoxysilyl]propyl]-3-triethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 171623585 |
| Molecular Formula | C32H76N2O11Si4 |
| Molecular Weight | 777.31 g/mol |
| Exact Mass | 776.45 |
| IUPAC Name | N-[3-[[diethoxy-[3-(3-triethoxysilylpropylamino)propyl]silyl]oxy-diethoxysilyl]propyl]-3-triethoxysilylpropan-1-amine |
| SMILES | CCO[Si](CCCNCCC[Si](OCC)(OCC)O[Si](CCCNCCC[Si](OCC)(OCC)OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C32H76N2O11Si4/c1-11-35-46(36-12-2,37-13-3)29-21-25-33-27-23-31-48(41-17-7,42-18-8)45-49(43-19-9,44-20-10)32-24-28-34-26-22-30-47(38-14-4,39-15-5)40-16-6/h33-34H,11-32H2,1-10H3 |
| InChIKey | RDYHVHAIESWZQA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.31 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|