C16H40N2O5Si2 — CID 171623611
3-[[dimethoxy-[3-(propylamino)propyl]silyl]oxy-dimethoxysilyl]-N-propylpropan-1-amine (PubChem CID 171623611) has the molecular formula C16H40N2O5Si2 and a molecular weight of 396.68 g/mol. Its IUPAC name is 3-[[dimethoxy-[3-(propylamino)propyl]silyl]oxy-dimethoxysilyl]-N-propylpropan-1-amine.
| Compound Name | 3-[[dimethoxy-[3-(propylamino)propyl]silyl]oxy-dimethoxysilyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 171623611 |
| Molecular Formula | C16H40N2O5Si2 |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 3-[[dimethoxy-[3-(propylamino)propyl]silyl]oxy-dimethoxysilyl]-N-propylpropan-1-amine |
| SMILES | CCCNCCC[Si](OC)(OC)O[Si](CCCNCCC)(OC)OC |
| InChI | InChI=1S/C16H40N2O5Si2/c1-7-11-17-13-9-15-24(19-3,20-4)23-25(21-5,22-6)16-10-14-18-12-8-2/h17-18H,7-16H2,1-6H3 |
| InChIKey | QXYZTRGBPZVYRS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 70.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|