C12H30N4O3Si — CID 59649171
2-[2-(3-triethoxysilylpropylamino)ethyl]guanidine (PubChem CID 59649171) has the molecular formula C12H30N4O3Si and a molecular weight of 306.48 g/mol. Its IUPAC name is 2-[2-(3-triethoxysilylpropylamino)ethyl]guanidine.
| Compound Name | 2-[2-(3-triethoxysilylpropylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 59649171 |
| Molecular Formula | C12H30N4O3Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 2-[2-(3-triethoxysilylpropylamino)ethyl]guanidine |
| SMILES | CCO[Si](CCCNCCN=C(N)N)(OCC)OCC |
| InChI | InChI=1S/C12H30N4O3Si/c1-4-17-20(18-5-2,19-6-3)11-7-8-15-9-10-16-12(13)14/h15H,4-11H2,1-3H3,(H4,13,14,16) |
| InChIKey | XBISPZKGDFNUJN-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|