C19H50N4O6Si2 — CID 87775603
N'-(3-triethoxysilylpropyl)ethane-1,2-diamine;N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine (PubChem CID 87775603) has the molecular formula C19H50N4O6Si2 and a molecular weight of 486.80 g/mol. Its IUPAC name is N'-(3-triethoxysilylpropyl)ethane-1,2-diamine;N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine.
| Compound Name | N'-(3-triethoxysilylpropyl)ethane-1,2-diamine;N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 87775603 |
| Molecular Formula | C19H50N4O6Si2 |
| Molecular Weight | 486.80 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | N'-(3-triethoxysilylpropyl)ethane-1,2-diamine;N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine |
| SMILES | CCO[Si](CCCNCCN)(OCC)OCC.CO[Si](CCCNCCN)(OC)OC |
| InChI | InChI=1S/C11H28N2O3Si.C8H22N2O3Si/c1-4-14-17(15-5-2,16-6-3)11-7-9-13-10-8-12;1-11-14(12-2,13-3)8-4-6-10-7-5-9/h13H,4-12H2,1-3H3;10H,4-9H2,1-3H3 |
| InChIKey | FIQAMKBXKOEHET-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 131.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.80 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|