C17H45N3O5Si2 — CID 173380907
1-dimethoxysilylbutan-2-amine;N'-(3-triethoxysilylpropyl)ethane-1,2-diamine (PubChem CID 173380907) has the molecular formula C17H45N3O5Si2 and a molecular weight of 427.74 g/mol. Its IUPAC name is 1-dimethoxysilylbutan-2-amine;N'-(3-triethoxysilylpropyl)ethane-1,2-diamine.
| Compound Name | 1-dimethoxysilylbutan-2-amine;N'-(3-triethoxysilylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 173380907 |
| Molecular Formula | C17H45N3O5Si2 |
| Molecular Weight | 427.74 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | 1-dimethoxysilylbutan-2-amine;N'-(3-triethoxysilylpropyl)ethane-1,2-diamine |
| SMILES | CCC(N)C[SiH](OC)OC.CCO[Si](CCCNCCN)(OCC)OCC |
| InChI | InChI=1S/C11H28N2O3Si.C6H17NO2Si/c1-4-14-17(15-5-2,16-6-3)11-7-9-13-10-8-12;1-4-6(7)5-10(8-2)9-3/h13H,4-12H2,1-3H3;6,10H,4-5,7H2,1-3H3 |
| InChIKey | UXHVMCDNRUEWTI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.74 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|