C17H40N2O3Si — CID 18366419
N'-[3-tri(butan-2-yloxy)silylpropyl]ethane-1,2-diamine (PubChem CID 18366419) has the molecular formula C17H40N2O3Si and a molecular weight of 348.60 g/mol. Its IUPAC name is N'-[3-tri(butan-2-yloxy)silylpropyl]ethane-1,2-diamine.
| Compound Name | N'-[3-tri(butan-2-yloxy)silylpropyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 18366419 |
| Molecular Formula | C17H40N2O3Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | N'-[3-tri(butan-2-yloxy)silylpropyl]ethane-1,2-diamine |
| SMILES | CCC(C)O[Si](CCCNCCN)(OC(C)CC)OC(C)CC |
| InChI | InChI=1S/C17H40N2O3Si/c1-7-15(4)20-23(21-16(5)8-2,22-17(6)9-3)14-10-12-19-13-11-18/h15-17,19H,7-14,18H2,1-6H3 |
| InChIKey | XYRLXKVOGUCZAX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|