C19H50N4O5Si2 — CID 162079222
N'-[3-(dimethoxymethylsilyl)propyl]ethane-1,2-diamine;N'-(3-triethoxysilylpropyl)ethane-1,2-diamine (PubChem CID 162079222) has the molecular formula C19H50N4O5Si2 and a molecular weight of 470.80 g/mol. Its IUPAC name is N'-[3-(dimethoxymethylsilyl)propyl]ethane-1,2-diamine;N'-(3-triethoxysilylpropyl)ethane-1,2-diamine.
| Compound Name | N'-[3-(dimethoxymethylsilyl)propyl]ethane-1,2-diamine;N'-(3-triethoxysilylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 162079222 |
| Molecular Formula | C19H50N4O5Si2 |
| Molecular Weight | 470.80 g/mol |
| Exact Mass | 470.33 |
| IUPAC Name | N'-[3-(dimethoxymethylsilyl)propyl]ethane-1,2-diamine;N'-(3-triethoxysilylpropyl)ethane-1,2-diamine |
| SMILES | CCO[Si](CCCNCCN)(OCC)OCC.COC(OC)[SiH2]CCCNCCN |
| InChI | InChI=1S/C11H28N2O3Si.C8H22N2O2Si/c1-4-14-17(15-5-2,16-6-3)11-7-9-13-10-8-12;1-11-8(12-2)13-7-3-5-10-6-4-9/h13H,4-12H2,1-3H3;8,10H,3-7,9,13H2,1-2H3 |
| InChIKey | ZCCOUYHXWXDLCP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 122.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.80 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|