About 3-(dimethoxymethylsilyl)propane-1-thiol;4-triethoxysilylbutan-1-ol
3-(dimethoxymethylsilyl)propane-1-thiol;4-triethoxysilylbutan-1-ol (PubChem CID 172805791) has the molecular formula C16H40O6SSi2
and a molecular weight of 416.73 g/mol. Its IUPAC name is 3-(dimethoxymethylsilyl)propane-1-thiol;4-triethoxysilylbutan-1-ol.
Molecular Properties
| Compound Name | 3-(dimethoxymethylsilyl)propane-1-thiol;4-triethoxysilylbutan-1-ol |
| PubChem CID | 172805791 |
| Molecular Formula | C16H40O6SSi2 |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 3-(dimethoxymethylsilyl)propane-1-thiol;4-triethoxysilylbutan-1-ol |
| SMILES | CCO[Si](CCCCO)(OCC)OCC.COC(OC)[SiH2]CCCS |
| InChI | InChI=1S/C10H24O4Si.C6H16O2SSi/c1-4-12-15(13-5-2,14-6-3)10-8-7-9-11;1-7-6(8-2)10-5-3-4-9/h11H,4-10H2,1-3H3;6,9H,3-5,10H2,1-2H3 |
| InChIKey | RMKJSLASCHDXDC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethoxymethylsilyl)propane-1-thiol;4-triethoxysilylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethoxymethylsilyl)propane-1-thiol;4-triethoxysilylbutan-1-ol?
The IUPAC name of 3-(dimethoxymethylsilyl)propane-1-thiol;4-triethoxysilylbutan-1-ol (CID 172805791) is 3-(dimethoxymethylsilyl)propane-1-thiol;4-triethoxysilylbutan-1-ol.
What is the SMILES notation for 3-(dimethoxymethylsilyl)propane-1-thiol;4-triethoxysilylbutan-1-ol?
The canonical SMILES for 3-(dimethoxymethylsilyl)propane-1-thiol;4-triethoxysilylbutan-1-ol is CCO[Si](CCCCO)(OCC)OCC.COC(OC)[SiH2]CCCS.
What is the InChIKey of 3-(dimethoxymethylsilyl)propane-1-thiol;4-triethoxysilylbutan-1-ol?
The InChIKey is RMKJSLASCHDXDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24O4Si.C6H16O2SSi/c1-4-12-15(13-5-2,14-6-3)10-8-7-9-11;1-7-6(8-2)10-5-3-4-9/h11H,4-10H2,1-3H3;6,9H,3-5,10H2,1-2H3.
What are the key properties of 3-(dimethoxymethylsilyl)propane-1-thiol;4-triethoxysilylbutan-1-ol?
3-(dimethoxymethylsilyl)propane-1-thiol;4-triethoxysilylbutan-1-ol has a molecular weight of 416.73 g/mol, XLogP of 2.28, 16 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethoxymethylsilyl)propane-1-thiol;4-triethoxysilylbutan-1-ol is sourced from PubChem (CID 172805791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).