C7H20N2O2Si — CID 3017669
N'-[2-(dimethoxymethylsilyl)ethyl]ethane-1,2-diamine (PubChem CID 3017669) has the molecular formula C7H20N2O2Si and a molecular weight of 192.33 g/mol. Its IUPAC name is N'-[2-(dimethoxymethylsilyl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(dimethoxymethylsilyl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 3017669 |
| Molecular Formula | C7H20N2O2Si |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N'-[2-(dimethoxymethylsilyl)ethyl]ethane-1,2-diamine |
| SMILES | COC(OC)[SiH2]CCNCCN |
| InChI | InChI=1S/C7H20N2O2Si/c1-10-7(11-2)12-6-5-9-4-3-8/h7,9H,3-6,8,12H2,1-2H3 |
| InChIKey | KLFRNPLTXAPRPB-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|