C9H24N2O2Si — CID 175524990
N'-[3-[1-methoxyethoxy(methyl)silyl]propyl]ethane-1,2-diamine (PubChem CID 175524990) has the molecular formula C9H24N2O2Si and a molecular weight of 220.39 g/mol. Its IUPAC name is N'-[3-[1-methoxyethoxy(methyl)silyl]propyl]ethane-1,2-diamine.
| Compound Name | N'-[3-[1-methoxyethoxy(methyl)silyl]propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 175524990 |
| Molecular Formula | C9H24N2O2Si |
| Molecular Weight | 220.39 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N'-[3-[1-methoxyethoxy(methyl)silyl]propyl]ethane-1,2-diamine |
| SMILES | COC(C)O[SiH](C)CCCNCCN |
| InChI | InChI=1S/C9H24N2O2Si/c1-9(12-2)13-14(3)8-4-6-11-7-5-10/h9,11,14H,4-8,10H2,1-3H3 |
| InChIKey | SFICOMXVXZQGOL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.39 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|