C13H31N3O3Si — CID 168864834
1-N'-[2-(3-triethoxysilylpropylamino)ethyl]ethene-1,1-diamine (PubChem CID 168864834) has the molecular formula C13H31N3O3Si and a molecular weight of 305.50 g/mol. Its IUPAC name is 1-N'-[2-(3-triethoxysilylpropylamino)ethyl]ethene-1,1-diamine.
| Compound Name | 1-N'-[2-(3-triethoxysilylpropylamino)ethyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 168864834 |
| Molecular Formula | C13H31N3O3Si |
| Molecular Weight | 305.50 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 1-N'-[2-(3-triethoxysilylpropylamino)ethyl]ethene-1,1-diamine |
| SMILES | C=C(N)NCCNCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C13H31N3O3Si/c1-5-17-20(18-6-2,19-7-3)12-8-9-15-10-11-16-13(4)14/h15-16H,4-12,14H2,1-3H3 |
| InChIKey | BCUFGUGYQPGZMY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.50 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|