C7H20N6 — CID 11355939
2-[2-[2-(2-aminoethylamino)ethylamino]ethyl]guanidine (PubChem CID 11355939) has the molecular formula C7H20N6 and a molecular weight of 188.28 g/mol. Its IUPAC name is 2-[2-[2-(2-aminoethylamino)ethylamino]ethyl]guanidine.
| Compound Name | 2-[2-[2-(2-aminoethylamino)ethylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 11355939 |
| Molecular Formula | C7H20N6 |
| Molecular Weight | 188.28 g/mol |
| Exact Mass | 188.17 |
| IUPAC Name | 2-[2-[2-(2-aminoethylamino)ethylamino]ethyl]guanidine |
| SMILES | NCCNCCNCCN=C(N)N |
| InChI | InChI=1S/C7H20N6/c8-1-2-11-3-4-12-5-6-13-7(9)10/h11-12H,1-6,8H2,(H4,9,10,13) |
| InChIKey | YHOFOXYUAQFIII-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.28 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|