C11H25N5O2 — CID 101181873
2-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethylimino]propanoic acid (PubChem CID 101181873) has the molecular formula C11H25N5O2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethylimino]propanoic acid.
| Compound Name | 2-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethylimino]propanoic acid |
|---|---|
| PubChem CID | 101181873 |
| Molecular Formula | C11H25N5O2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 2-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethylimino]propanoic acid |
| SMILES | C/C(=N\CCNCCNCCNCCN)C(=O)O |
| InChI | InChI=1S/C11H25N5O2/c1-10(11(17)18)16-9-8-15-7-6-14-5-4-13-3-2-12/h13-15H,2-9,12H2,1H3,(H,17,18)/b16-10+ |
| InChIKey | STHAYCUTDJPNBE-MHWRWJLKSA-N |
| XLogP | -1.74 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|